C17H18N4O3 — CID 108526668
N-(3-acetamidophenyl)-N'-(2-amino-5-methylphenyl)oxamide (PubChem CID 108526668) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-N'-(2-amino-5-methylphenyl)oxamide.
| Compound Name | N-(3-acetamidophenyl)-N'-(2-amino-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108526668 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | N-(3-acetamidophenyl)-N'-(2-amino-5-methylphenyl)oxamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)C(=O)Nc2cc(C)ccc2N)c1 |
| InChI | InChI=1S/C17H18N4O3/c1-10-6-7-14(18)15(8-10)21-17(24)16(23)20-13-5-3-4-12(9-13)19-11(2)22/h3-9H,18H2,1-2H3,(H,19,22)(H,20,23)(H,21,24) |
| InChIKey | IWMYBMRRUSUDKN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|