C16H14N4O2S — CID 108527869
[4-[[2-(2-amino-5-methylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108527869) has the molecular formula C16H14N4O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is [4-[[2-(2-amino-5-methylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(2-amino-5-methylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108527869 |
| Molecular Formula | C16H14N4O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.08 |
| IUPAC Name | [4-[[2-(2-amino-5-methylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1ccc(N)c(NC(=O)C(=O)Nc2ccc(SC#N)cc2)c1 |
| InChI | InChI=1S/C16H14N4O2S/c1-10-2-7-13(18)14(8-10)20-16(22)15(21)19-11-3-5-12(6-4-11)23-9-17/h2-8H,18H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | AOUUNMGIHZDEPJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|