C17H15N3O2S — CID 108515336
[4-[[2-(2,3-dimethylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108515336) has the molecular formula C17H15N3O2S and a molecular weight of 325.39 g/mol. Its IUPAC name is [4-[[2-(2,3-dimethylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-(2,3-dimethylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108515336 |
| Molecular Formula | C17H15N3O2S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | [4-[[2-(2,3-dimethylanilino)-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1cccc(NC(=O)C(=O)Nc2ccc(SC#N)cc2)c1C |
| InChI | InChI=1S/C17H15N3O2S/c1-11-4-3-5-15(12(11)2)20-17(22)16(21)19-13-6-8-14(9-7-13)23-10-18/h3-9H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | SVWRWJRUHHCAET-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|