C14H12N4O2S2 — CID 108527795
[4-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate (PubChem CID 108527795) has the molecular formula C14H12N4O2S2 and a molecular weight of 332.41 g/mol. Its IUPAC name is [4-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108527795 |
| Molecular Formula | C14H12N4O2S2 |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | [4-[[2-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-oxoacetyl]amino]phenyl] thiocyanate |
| SMILES | Cc1nc(NC(=O)C(=O)Nc2ccc(SC#N)cc2)sc1C |
| InChI | InChI=1S/C14H12N4O2S2/c1-8-9(2)22-14(16-8)18-13(20)12(19)17-10-3-5-11(6-4-10)21-7-15/h3-6H,1-2H3,(H,17,19)(H,16,18,20) |
| InChIKey | XDZFEZAJGSEFLC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|