C14H12F3N3O2S — CID 108501440
N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108501440) has the molecular formula C14H12F3N3O2S and a molecular weight of 343.33 g/mol. Its IUPAC name is N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108501440 |
| Molecular Formula | C14H12F3N3O2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | N'-(4,5-dimethyl-1,3-thiazol-2-yl)-N-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | Cc1nc(NC(=O)C(=O)Nc2cccc(C(F)(F)F)c2)sc1C |
| InChI | InChI=1S/C14H12F3N3O2S/c1-7-8(2)23-13(18-7)20-12(22)11(21)19-10-5-3-4-9(6-10)14(15,16)17/h3-6H,1-2H3,(H,19,21)(H,18,20,22) |
| InChIKey | AZDLWIJGBVVGTE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|