C12H8N4O2S2 — CID 108520026
[4-[[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl] thiocyanate (PubChem CID 108520026) has the molecular formula C12H8N4O2S2 and a molecular weight of 304.36 g/mol. Its IUPAC name is [4-[[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108520026 |
| Molecular Formula | C12H8N4O2S2 |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | [4-[[2-oxo-2-(1,3-thiazol-2-ylamino)acetyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C(=O)Nc2nccs2)cc1 |
| InChI | InChI=1S/C12H8N4O2S2/c13-7-20-9-3-1-8(2-4-9)15-10(17)11(18)16-12-14-5-6-19-12/h1-6H,(H,15,17)(H,14,16,18) |
| InChIKey | FOPKUAVOEVCOSB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|