C12H9N5O2S — CID 108520045
N-(1H-indazol-6-yl)-N'-(1,3-thiazol-2-yl)oxamide (PubChem CID 108520045) has the molecular formula C12H9N5O2S and a molecular weight of 287.30 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-N'-(1,3-thiazol-2-yl)oxamide.
| Compound Name | N-(1H-indazol-6-yl)-N'-(1,3-thiazol-2-yl)oxamide |
|---|---|
| PubChem CID | 108520045 |
| Molecular Formula | C12H9N5O2S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | N-(1H-indazol-6-yl)-N'-(1,3-thiazol-2-yl)oxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)C(=O)Nc1nccs1 |
| InChI | InChI=1S/C12H9N5O2S/c18-10(11(19)16-12-13-3-4-20-12)15-8-2-1-7-6-14-17-9(7)5-8/h1-6H,(H,14,17)(H,15,18)(H,13,16,19) |
| InChIKey | OENAKVNXZZCJKW-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|