About N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide
N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide (PubChem CID 108530108) has the molecular formula C18H13N5O2
and a molecular weight of 331.34 g/mol. Its IUPAC name is N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide.
Molecular Properties
| Compound Name | N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide |
| PubChem CID | 108530108 |
| Molecular Formula | C18H13N5O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide |
| SMILES | O=C(Nc1ccc2cn[nH]c2c1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C18H13N5O2/c24-17(21-13-7-6-12-10-20-23-15(12)9-13)18(25)22-14-5-1-3-11-4-2-8-19-16(11)14/h1-10H,(H,20,23)(H,21,24)(H,22,25) |
| InChIKey | KHZDDXXOJINZRE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide?
The IUPAC name of N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide (CID 108530108) is N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide.
What is the SMILES notation for N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide?
The canonical SMILES for N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide is O=C(Nc1ccc2cn[nH]c2c1)C(=O)Nc1cccc2cccnc12.
What is the InChIKey of N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide?
The InChIKey is KHZDDXXOJINZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13N5O2/c24-17(21-13-7-6-12-10-20-23-15(12)9-13)18(25)22-14-5-1-3-11-4-2-8-19-16(11)14/h1-10H,(H,20,23)(H,21,24)(H,22,25).
What are the key properties of N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide?
N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide has a molecular weight of 331.34 g/mol, XLogP of 2.69, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1H-indazol-6-yl)-N'-quinolin-8-yloxamide is sourced from PubChem (CID 108530108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).