About N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide
N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide (PubChem CID 108530535) has the molecular formula C17H11ClFN3O2
and a molecular weight of 343.75 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide.
Molecular Properties
| Compound Name | N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide |
| PubChem CID | 108530535 |
| Molecular Formula | C17H11ClFN3O2 |
| Molecular Weight | 343.75 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide |
| SMILES | O=C(Nc1ccc(F)c(Cl)c1)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C17H11ClFN3O2/c18-12-9-11(6-7-13(12)19)21-16(23)17(24)22-14-5-1-3-10-4-2-8-20-15(10)14/h1-9H,(H,21,23)(H,22,24) |
| InChIKey | ZMIGMRVMKPVCPI-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.75 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide?
The IUPAC name of N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide (CID 108530535) is N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide.
What is the SMILES notation for N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide?
The canonical SMILES for N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide is O=C(Nc1ccc(F)c(Cl)c1)C(=O)Nc1cccc2cccnc12.
What is the InChIKey of N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide?
The InChIKey is ZMIGMRVMKPVCPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClFN3O2/c18-12-9-11(6-7-13(12)19)21-16(23)17(24)22-14-5-1-3-10-4-2-8-20-15(10)14/h1-9H,(H,21,23)(H,22,24).
What are the key properties of N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide?
N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide has a molecular weight of 343.75 g/mol, XLogP of 3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloro-4-fluorophenyl)-N'-quinolin-8-yloxamide is sourced from PubChem (CID 108530535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).