C14H8Cl2F2N2O2 — CID 108987778
N'-(2,3-dichlorophenyl)-N-(3,4-difluorophenyl)oxamide (PubChem CID 108987778) has the molecular formula C14H8Cl2F2N2O2 and a molecular weight of 345.13 g/mol. Its IUPAC name is N'-(2,3-dichlorophenyl)-N-(3,4-difluorophenyl)oxamide.
| Compound Name | N'-(2,3-dichlorophenyl)-N-(3,4-difluorophenyl)oxamide |
|---|---|
| PubChem CID | 108987778 |
| Molecular Formula | C14H8Cl2F2N2O2 |
| Molecular Weight | 345.13 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | N'-(2,3-dichlorophenyl)-N-(3,4-difluorophenyl)oxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C14H8Cl2F2N2O2/c15-8-2-1-3-11(12(8)16)20-14(22)13(21)19-7-4-5-9(17)10(18)6-7/h1-6H,(H,19,21)(H,20,22) |
| InChIKey | JOXFZDUSZRIWPK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.13 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|