C16H12Cl2N2O3 — CID 108500714
N'-(3-acetylphenyl)-N-(2,3-dichlorophenyl)oxamide (PubChem CID 108500714) has the molecular formula C16H12Cl2N2O3 and a molecular weight of 351.19 g/mol. Its IUPAC name is N'-(3-acetylphenyl)-N-(2,3-dichlorophenyl)oxamide.
| Compound Name | N'-(3-acetylphenyl)-N-(2,3-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108500714 |
| Molecular Formula | C16H12Cl2N2O3 |
| Molecular Weight | 351.19 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | N'-(3-acetylphenyl)-N-(2,3-dichlorophenyl)oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C16H12Cl2N2O3/c1-9(21)10-4-2-5-11(8-10)19-15(22)16(23)20-13-7-3-6-12(17)14(13)18/h2-8H,1H3,(H,19,22)(H,20,23) |
| InChIKey | OWKKTZKNHSYZMH-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|