C15H13Cl2N2O2+ — CID 8831367
2-(3-acetylpyridin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide (PubChem CID 8831367) has the molecular formula C15H13Cl2N2O2+ and a molecular weight of 324.19 g/mol. Its IUPAC name is 2-(3-acetylpyridin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide.
| Compound Name | 2-(3-acetylpyridin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 8831367 |
| Molecular Formula | C15H13Cl2N2O2+ |
| Molecular Weight | 324.19 g/mol |
| Exact Mass | 323.03 |
| IUPAC Name | 2-(3-acetylpyridin-1-ium-1-yl)-N-(2,3-dichlorophenyl)acetamide |
| SMILES | CC(=O)c1ccc[n+](CC(=O)Nc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C15H12Cl2N2O2/c1-10(20)11-4-3-7-19(8-11)9-14(21)18-13-6-2-5-12(16)15(13)17/h2-8H,9H2,1H3/p+1 |
| InChIKey | QWZPOUFTXVBINV-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 50.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.19 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|