C20H16N2O4 — CID 108509256
N-(3-acetylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide (PubChem CID 108509256) has the molecular formula C20H16N2O4 and a molecular weight of 348.36 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide.
| Compound Name | N-(3-acetylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 108509256 |
| Molecular Formula | C20H16N2O4 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-(3-acetylphenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(=O)Nc2cccc3c(O)cccc23)c1 |
| InChI | InChI=1S/C20H16N2O4/c1-12(23)13-5-2-6-14(11-13)21-19(25)20(26)22-17-9-3-8-16-15(17)7-4-10-18(16)24/h2-11,24H,1H3,(H,21,25)(H,22,26) |
| InChIKey | PTTGCJQIXQKLEG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|