C24H19N3O3 — CID 108509324
N-(4-anilinophenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide (PubChem CID 108509324) has the molecular formula C24H19N3O3 and a molecular weight of 397.43 g/mol. Its IUPAC name is N-(4-anilinophenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide.
| Compound Name | N-(4-anilinophenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
|---|---|
| PubChem CID | 108509324 |
| Molecular Formula | C24H19N3O3 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | N-(4-anilinophenyl)-N'-(5-hydroxynaphthalen-1-yl)oxamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C24H19N3O3/c28-22-11-5-8-19-20(22)9-4-10-21(19)27-24(30)23(29)26-18-14-12-17(13-15-18)25-16-6-2-1-3-7-16/h1-15,25,28H,(H,26,29)(H,27,30) |
| InChIKey | FRXPQLFSHZOVHD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|