C15H17NO2 — CID 64590909
N-(5-hydroxynaphthalen-1-yl)-2,2-dimethylpropanamide (PubChem CID 64590909) has the molecular formula C15H17NO2 and a molecular weight of 243.31 g/mol. Its IUPAC name is N-(5-hydroxynaphthalen-1-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(5-hydroxynaphthalen-1-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 64590909 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | N-(5-hydroxynaphthalen-1-yl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C15H17NO2/c1-15(2,3)14(18)16-12-8-4-7-11-10(12)6-5-9-13(11)17/h4-9,17H,1-3H3,(H,16,18) |
| InChIKey | VZSZYAMSVRGSNZ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |