C21H33N3O3 — CID 141287633
N-[2,3-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide (PubChem CID 141287633) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is N-[2,3-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2,3-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 141287633 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | N-[2,3-bis(2,2-dimethylpropanoylamino)phenyl]-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1cccc(NC(=O)C(C)(C)C)c1NC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H33N3O3/c1-19(2,3)16(25)22-13-11-10-12-14(23-17(26)20(4,5)6)15(13)24-18(27)21(7,8)9/h10-12H,1-9H3,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | YENPKFXTOLNSBS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |