C15H13F8NO3 — CID 158193392
N-(2,6-difluorophenyl)-2,2-dimethylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione (PubChem CID 158193392) has the molecular formula C15H13F8NO3 and a molecular weight of 407.26 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2,2-dimethylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione.
| Compound Name | N-(2,6-difluorophenyl)-2,2-dimethylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
|---|---|
| PubChem CID | 158193392 |
| Molecular Formula | C15H13F8NO3 |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | N-(2,6-difluorophenyl)-2,2-dimethylpropanamide;1,1,1,4,4,4-hexafluorobutane-2,3-dione |
| SMILES | CC(C)(C)C(=O)Nc1c(F)cccc1F.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H13F2NO.C4F6O2/c1-11(2,3)10(15)14-9-7(12)5-4-6-8(9)13;5-3(6,7)1(11)2(12)4(8,9)10/h4-6H,1-3H3,(H,14,15); |
| InChIKey | GAARMNJIDPNLFW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|