C16H17F6NO4 — CID 158094253
1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-methoxyphenyl)-2,2-dimethylpropanamide (PubChem CID 158094253) has the molecular formula C16H17F6NO4 and a molecular weight of 401.30 g/mol. Its IUPAC name is 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-methoxyphenyl)-2,2-dimethylpropanamide.
| Compound Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-methoxyphenyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 158094253 |
| Molecular Formula | C16H17F6NO4 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | 1,1,1,4,4,4-hexafluorobutane-2,3-dione;N-(4-methoxyphenyl)-2,2-dimethylpropanamide |
| SMILES | COc1ccc(NC(=O)C(C)(C)C)cc1.O=C(C(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17NO2.C4F6O2/c1-12(2,3)11(14)13-9-5-7-10(15-4)8-6-9;5-3(6,7)1(11)2(12)4(8,9)10/h5-8H,1-4H3,(H,13,14); |
| InChIKey | FOMCFHKEVULWLY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|