C11H13F3N2O2 — CID 79788488
2-amino-3,3,3-trifluoro-N-(4-methoxyphenyl)-2-methylpropanamide (PubChem CID 79788488) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N-(4-methoxyphenyl)-2-methylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N-(4-methoxyphenyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 79788488 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N-(4-methoxyphenyl)-2-methylpropanamide |
| SMILES | COc1ccc(NC(=O)C(C)(N)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-10(15,11(12,13)14)9(17)16-7-3-5-8(18-2)6-4-7/h3-6H,15H2,1-2H3,(H,16,17) |
| InChIKey | RUUQQZLGBXQEDL-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |