C24H24F3N3O4 — CID 2380112
3,3,3-trifluoro-2,2-bis(4-methoxyanilino)-N-(4-methoxyphenyl)propanamide (PubChem CID 2380112) has the molecular formula C24H24F3N3O4 and a molecular weight of 475.47 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-bis(4-methoxyanilino)-N-(4-methoxyphenyl)propanamide.
| Compound Name | 3,3,3-trifluoro-2,2-bis(4-methoxyanilino)-N-(4-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 2380112 |
| Molecular Formula | C24H24F3N3O4 |
| Molecular Weight | 475.47 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 3,3,3-trifluoro-2,2-bis(4-methoxyanilino)-N-(4-methoxyphenyl)propanamide |
| SMILES | COc1ccc(NC(=O)C(Nc2ccc(OC)cc2)(Nc2ccc(OC)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3N3O4/c1-32-19-10-4-16(5-11-19)28-22(31)23(24(25,26)27,29-17-6-12-20(33-2)13-7-17)30-18-8-14-21(34-3)15-9-18/h4-15,29-30H,1-3H3,(H,28,31) |
| InChIKey | FZHNMLLJTVWAEJ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|