C24H24F3N3O — CID 2305407
3,3,3-trifluoro-2,2-bis(4-methylanilino)-N-(4-methylphenyl)propanamide (PubChem CID 2305407) has the molecular formula C24H24F3N3O and a molecular weight of 427.47 g/mol. Its IUPAC name is 3,3,3-trifluoro-2,2-bis(4-methylanilino)-N-(4-methylphenyl)propanamide.
| Compound Name | 3,3,3-trifluoro-2,2-bis(4-methylanilino)-N-(4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 2305407 |
| Molecular Formula | C24H24F3N3O |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 3,3,3-trifluoro-2,2-bis(4-methylanilino)-N-(4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)C(Nc2ccc(C)cc2)(Nc2ccc(C)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H24F3N3O/c1-16-4-10-19(11-5-16)28-22(31)23(24(25,26)27,29-20-12-6-17(2)7-13-20)30-21-14-8-18(3)9-15-21/h4-15,29-30H,1-3H3,(H,28,31) |
| InChIKey | QYEQECUVFRBJQW-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|