C14H14F3N3O4 — CID 137288115
ethyl 2-diazo-4,4,4-trifluoro-3-hydroxy-3-[(4-methylphenyl)carbamoyl]butanoate (PubChem CID 137288115) has the molecular formula C14H14F3N3O4 and a molecular weight of 345.28 g/mol. Its IUPAC name is ethyl 2-diazo-4,4,4-trifluoro-3-hydroxy-3-[(4-methylphenyl)carbamoyl]butanoate.
| Compound Name | ethyl 2-diazo-4,4,4-trifluoro-3-hydroxy-3-[(4-methylphenyl)carbamoyl]butanoate |
|---|---|
| PubChem CID | 137288115 |
| Molecular Formula | C14H14F3N3O4 |
| Molecular Weight | 345.28 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | ethyl 2-diazo-4,4,4-trifluoro-3-hydroxy-3-[(4-methylphenyl)carbamoyl]butanoate |
| SMILES | CCOC(=O)C(=[N+]=[N-])C(O)(C(=O)Nc1ccc(C)cc1)C(F)(F)F |
| InChI | InChI=1S/C14H14F3N3O4/c1-3-24-11(21)10(20-18)13(23,14(15,16)17)12(22)19-9-6-4-8(2)5-7-9/h4-7,23H,3H2,1-2H3,(H,19,22) |
| InChIKey | NLMGQIZTMZYUBA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|