C22H27NO2 — CID 101460532
ethyl (Z,4S)-2-(4-methylanilino)-4-(4-methylphenyl)hex-2-enoate (PubChem CID 101460532) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is ethyl (Z,4S)-2-(4-methylanilino)-4-(4-methylphenyl)hex-2-enoate.
| Compound Name | ethyl (Z,4S)-2-(4-methylanilino)-4-(4-methylphenyl)hex-2-enoate |
|---|---|
| PubChem CID | 101460532 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | ethyl (Z,4S)-2-(4-methylanilino)-4-(4-methylphenyl)hex-2-enoate |
| SMILES | CCOC(=O)/C(=C/[C@H](CC)c1ccc(C)cc1)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-5-18(19-11-7-16(3)8-12-19)15-21(22(24)25-6-2)23-20-13-9-17(4)10-14-20/h7-15,18,23H,5-6H2,1-4H3/b21-15-/t18-/m0/s1 |
| InChIKey | BKWXPRMTXMGUQE-IGCAKMCNSA-N |
| XLogP | 5.36 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|