C15H19NO6 — CID 134869272
1-O-ethyl 4-O-methyl (E)-2-(3,4-dimethoxyanilino)but-2-enedioate (PubChem CID 134869272) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 1-O-ethyl 4-O-methyl (E)-2-(3,4-dimethoxyanilino)but-2-enedioate.
| Compound Name | 1-O-ethyl 4-O-methyl (E)-2-(3,4-dimethoxyanilino)but-2-enedioate |
|---|---|
| PubChem CID | 134869272 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 1-O-ethyl 4-O-methyl (E)-2-(3,4-dimethoxyanilino)but-2-enedioate |
| SMILES | CCOC(=O)/C(=C\C(=O)OC)Nc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H19NO6/c1-5-22-15(18)11(9-14(17)21-4)16-10-6-7-12(19-2)13(8-10)20-3/h6-9,16H,5H2,1-4H3/b11-9+ |
| InChIKey | DRIHEYIKXGPJGV-PKNBQFBNSA-N |
| XLogP | 1.74 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|