C20H22N2O6 — CID 108956010
ethyl 4-[[3-(3,4-dimethoxyanilino)-3-oxopropanoyl]amino]benzoate (PubChem CID 108956010) has the molecular formula C20H22N2O6 and a molecular weight of 386.40 g/mol. Its IUPAC name is ethyl 4-[[3-(3,4-dimethoxyanilino)-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 4-[[3-(3,4-dimethoxyanilino)-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 108956010 |
| Molecular Formula | C20H22N2O6 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 4-[[3-(3,4-dimethoxyanilino)-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CC(=O)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H22N2O6/c1-4-28-20(25)13-5-7-14(8-6-13)21-18(23)12-19(24)22-15-9-10-16(26-2)17(11-15)27-3/h5-11H,4,12H2,1-3H3,(H,21,23)(H,22,24) |
| InChIKey | HGEMSQYRCNMJPQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|