C19H21NO5 — CID 2677147
ethyl 4-[(3,5-dimethoxy-4-methylbenzoyl)amino]benzoate (PubChem CID 2677147) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 4-[(3,5-dimethoxy-4-methylbenzoyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,5-dimethoxy-4-methylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 2677147 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | ethyl 4-[(3,5-dimethoxy-4-methylbenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(OC)c(C)c(OC)c2)cc1 |
| InChI | InChI=1S/C19H21NO5/c1-5-25-19(22)13-6-8-15(9-7-13)20-18(21)14-10-16(23-3)12(2)17(11-14)24-4/h6-11H,5H2,1-4H3,(H,20,21) |
| InChIKey | KQKYRIGATIVJKJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |