C20H26N2O3 — CID 2665776
N-[4-(diethylamino)phenyl]-3,5-dimethoxy-4-methylbenzamide (PubChem CID 2665776) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-3,5-dimethoxy-4-methylbenzamide.
| Compound Name | N-[4-(diethylamino)phenyl]-3,5-dimethoxy-4-methylbenzamide |
|---|---|
| PubChem CID | 2665776 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-3,5-dimethoxy-4-methylbenzamide |
| SMILES | CCN(CC)c1ccc(NC(=O)c2cc(OC)c(C)c(OC)c2)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-6-22(7-2)17-10-8-16(9-11-17)21-20(23)15-12-18(24-4)14(3)19(13-15)25-5/h8-13H,6-7H2,1-5H3,(H,21,23) |
| InChIKey | IXQSSMNCFFGLFQ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|