C24H31NO4 — CID 86605115
ethyl 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoate (PubChem CID 86605115) has the molecular formula C24H31NO4 and a molecular weight of 397.52 g/mol. Its IUPAC name is ethyl 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoate.
| Compound Name | ethyl 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 86605115 |
| Molecular Formula | C24H31NO4 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.23 |
| IUPAC Name | ethyl 4-[(3,5-ditert-butyl-4-hydroxybenzoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C24H31NO4/c1-8-29-22(28)15-9-11-17(12-10-15)25-21(27)16-13-18(23(2,3)4)20(26)19(14-16)24(5,6)7/h9-14,26H,8H2,1-7H3,(H,25,27) |
| InChIKey | WUQLKMNUBBLXFL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |