C15H17F2NO6 — CID 168567761
dimethyl (E)-2-[3-(2,2-difluoroethoxy)-4-methoxyanilino]but-2-enedioate (PubChem CID 168567761) has the molecular formula C15H17F2NO6 and a molecular weight of 345.30 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(2,2-difluoroethoxy)-4-methoxyanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(2,2-difluoroethoxy)-4-methoxyanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567761 |
| Molecular Formula | C15H17F2NO6 |
| Molecular Weight | 345.30 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | dimethyl (E)-2-[3-(2,2-difluoroethoxy)-4-methoxyanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(OC)c(OCC(F)F)c1)C(=O)OC |
| InChI | InChI=1S/C15H17F2NO6/c1-21-11-5-4-9(6-12(11)24-8-13(16)17)18-10(15(20)23-3)7-14(19)22-2/h4-7,13,18H,8H2,1-3H3/b10-7+ |
| InChIKey | NNPFWVZSLWTSLV-JXMROGBWSA-N |
| XLogP | 1.98 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|