C12H11Cl2NO4 — CID 22301916
dimethyl (Z)-2-(3,4-dichloroanilino)but-2-enedioate (PubChem CID 22301916) has the molecular formula C12H11Cl2NO4 and a molecular weight of 304.13 g/mol. Its IUPAC name is dimethyl (Z)-2-(3,4-dichloroanilino)but-2-enedioate.
| Compound Name | dimethyl (Z)-2-(3,4-dichloroanilino)but-2-enedioate |
|---|---|
| PubChem CID | 22301916 |
| Molecular Formula | C12H11Cl2NO4 |
| Molecular Weight | 304.13 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | dimethyl (Z)-2-(3,4-dichloroanilino)but-2-enedioate |
| SMILES | COC(=O)/C=C(\Nc1ccc(Cl)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C12H11Cl2NO4/c1-18-11(16)6-10(12(17)19-2)15-7-3-4-8(13)9(14)5-7/h3-6,15H,1-2H3/b10-6- |
| InChIKey | OZMFGQQNNWNJMS-POHAHGRESA-N |
| XLogP | 2.64 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.13 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|