C11H11Cl2NO2 — CID 139239204
methyl (Z)-3-(3,4-dichloroanilino)but-2-enoate (PubChem CID 139239204) has the molecular formula C11H11Cl2NO2 and a molecular weight of 260.12 g/mol. Its IUPAC name is methyl (Z)-3-(3,4-dichloroanilino)but-2-enoate.
| Compound Name | methyl (Z)-3-(3,4-dichloroanilino)but-2-enoate |
|---|---|
| PubChem CID | 139239204 |
| Molecular Formula | C11H11Cl2NO2 |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | methyl (Z)-3-(3,4-dichloroanilino)but-2-enoate |
| SMILES | COC(=O)/C=C(/C)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H11Cl2NO2/c1-7(5-11(15)16-2)14-8-3-4-9(12)10(13)6-8/h3-6,14H,1-2H3/b7-5- |
| InChIKey | ACBKFEAVQZZKHN-ALCCZGGFSA-N |
| XLogP | 3.48 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|