C19H15ClN2O4S — CID 168567823
dimethyl (E)-2-[4-(1,3-benzothiazol-2-yl)-3-chloroanilino]but-2-enedioate (PubChem CID 168567823) has the molecular formula C19H15ClN2O4S and a molecular weight of 402.86 g/mol. Its IUPAC name is dimethyl (E)-2-[4-(1,3-benzothiazol-2-yl)-3-chloroanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[4-(1,3-benzothiazol-2-yl)-3-chloroanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168567823 |
| Molecular Formula | C19H15ClN2O4S |
| Molecular Weight | 402.86 g/mol |
| Exact Mass | 402.04 |
| IUPAC Name | dimethyl (E)-2-[4-(1,3-benzothiazol-2-yl)-3-chloroanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc(-c2nc3ccccc3s2)c(Cl)c1)C(=O)OC |
| InChI | InChI=1S/C19H15ClN2O4S/c1-25-17(23)10-15(19(24)26-2)21-11-7-8-12(13(20)9-11)18-22-14-5-3-4-6-16(14)27-18/h3-10,21H,1-2H3/b15-10+ |
| InChIKey | ITFUJMBCUWURMX-XNTDXEJSSA-N |
| XLogP | 4.26 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.86 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|