C19H17N3O4S — CID 168568284
dimethyl (E)-2-[3-(6-amino-1,3-benzothiazol-2-yl)anilino]but-2-enedioate (PubChem CID 168568284) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is dimethyl (E)-2-[3-(6-amino-1,3-benzothiazol-2-yl)anilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[3-(6-amino-1,3-benzothiazol-2-yl)anilino]but-2-enedioate |
|---|---|
| PubChem CID | 168568284 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | dimethyl (E)-2-[3-(6-amino-1,3-benzothiazol-2-yl)anilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cccc(-c2nc3ccc(N)cc3s2)c1)C(=O)OC |
| InChI | InChI=1S/C19H17N3O4S/c1-25-17(23)10-15(19(24)26-2)21-13-5-3-4-11(8-13)18-22-14-7-6-12(20)9-16(14)27-18/h3-10,21H,20H2,1-2H3/b15-10+ |
| InChIKey | HFHAOWLUPOQZPH-XNTDXEJSSA-N |
| XLogP | 3.19 |
| TPSA | 103.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|