C16H18N2O4S — CID 168568132
dimethyl (E)-2-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]but-2-enedioate (PubChem CID 168568132) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is dimethyl (E)-2-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168568132 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | dimethyl (E)-2-[(2-propan-2-yl-1,3-benzothiazol-6-yl)amino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1ccc2nc(C(C)C)sc2c1)C(=O)OC |
| InChI | InChI=1S/C16H18N2O4S/c1-9(2)15-18-11-6-5-10(7-13(11)23-15)17-12(16(20)22-4)8-14(19)21-3/h5-9,17H,1-4H3/b12-8+ |
| InChIKey | BIPTUFJTWYDFSW-XYOKQWHBSA-N |
| XLogP | 3.06 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|