C15H16N2O4S2 — CID 168569245
dimethyl (E)-2-[(2-ethylsulfanyl-1,3-benzothiazol-6-yl)amino]but-2-enedioate (PubChem CID 168569245) has the molecular formula C15H16N2O4S2 and a molecular weight of 352.44 g/mol. Its IUPAC name is dimethyl (E)-2-[(2-ethylsulfanyl-1,3-benzothiazol-6-yl)amino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[(2-ethylsulfanyl-1,3-benzothiazol-6-yl)amino]but-2-enedioate |
|---|---|
| PubChem CID | 168569245 |
| Molecular Formula | C15H16N2O4S2 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | dimethyl (E)-2-[(2-ethylsulfanyl-1,3-benzothiazol-6-yl)amino]but-2-enedioate |
| SMILES | CCSc1nc2ccc(N/C(=C/C(=O)OC)C(=O)OC)cc2s1 |
| InChI | InChI=1S/C15H16N2O4S2/c1-4-22-15-17-10-6-5-9(7-12(10)23-15)16-11(14(19)21-3)8-13(18)20-2/h5-8,16H,4H2,1-3H3/b11-8+ |
| InChIKey | BEQSEATVOIGOQM-DHZHZOJOSA-N |
| XLogP | 3.05 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|