C19H15ClN2O4S2 — CID 168566757
dimethyl (E)-2-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-chloroanilino]but-2-enedioate (PubChem CID 168566757) has the molecular formula C19H15ClN2O4S2 and a molecular weight of 434.93 g/mol. Its IUPAC name is dimethyl (E)-2-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-chloroanilino]but-2-enedioate.
| Compound Name | dimethyl (E)-2-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-chloroanilino]but-2-enedioate |
|---|---|
| PubChem CID | 168566757 |
| Molecular Formula | C19H15ClN2O4S2 |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | dimethyl (E)-2-[2-(1,3-benzothiazol-2-ylsulfanyl)-5-chloroanilino]but-2-enedioate |
| SMILES | COC(=O)/C=C(/Nc1cc(Cl)ccc1Sc1nc2ccccc2s1)C(=O)OC |
| InChI | InChI=1S/C19H15ClN2O4S2/c1-25-17(23)10-14(18(24)26-2)21-13-9-11(20)7-8-16(13)28-19-22-12-5-3-4-6-15(12)27-19/h3-10,21H,1-2H3/b14-10+ |
| InChIKey | NCSUIIMAHDEZOF-GXDHUFHOSA-N |
| XLogP | 4.74 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|