C15H12ClN3O2S2 — CID 155908019
methyl N-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroanilino]carbamate (PubChem CID 155908019) has the molecular formula C15H12ClN3O2S2 and a molecular weight of 365.87 g/mol. Its IUPAC name is methyl N-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroanilino]carbamate.
| Compound Name | methyl N-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroanilino]carbamate |
|---|---|
| PubChem CID | 155908019 |
| Molecular Formula | C15H12ClN3O2S2 |
| Molecular Weight | 365.87 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | methyl N-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-chloroanilino]carbamate |
| SMILES | COC(=O)NNc1ccc(Sc2nc3ccccc3s2)c(Cl)c1 |
| InChI | InChI=1S/C15H12ClN3O2S2/c1-21-14(20)19-18-9-6-7-12(10(16)8-9)22-15-17-11-4-2-3-5-13(11)23-15/h2-8,18H,1H3,(H,19,20) |
| InChIKey | RNWURTNAEXOFII-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.87 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|