C15H11NOS2 — CID 55238001
4-(1,3-benzothiazol-2-ylsulfanyl)-3-methylbenzaldehyde (PubChem CID 55238001) has the molecular formula C15H11NOS2 and a molecular weight of 285.39 g/mol. Its IUPAC name is 4-(1,3-benzothiazol-2-ylsulfanyl)-3-methylbenzaldehyde.
| Compound Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3-methylbenzaldehyde |
|---|---|
| PubChem CID | 55238001 |
| Molecular Formula | C15H11NOS2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 4-(1,3-benzothiazol-2-ylsulfanyl)-3-methylbenzaldehyde |
| SMILES | Cc1cc(C=O)ccc1Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H11NOS2/c1-10-8-11(9-17)6-7-13(10)18-15-16-12-4-2-3-5-14(12)19-15/h2-9H,1H3 |
| InChIKey | NJJNSQUFBNPRCH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|