C11H6N2OS3 — CID 1484909
2-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazole-5-carbaldehyde (PubChem CID 1484909) has the molecular formula C11H6N2OS3 and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 1484909 |
| Molecular Formula | C11H6N2OS3 |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 277.96 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-1,3-thiazole-5-carbaldehyde |
| SMILES | O=Cc1cnc(Sc2nc3ccccc3s2)s1 |
| InChI | InChI=1S/C11H6N2OS3/c14-6-7-5-12-10(15-7)17-11-13-8-3-1-2-4-9(8)16-11/h1-6H |
| InChIKey | ORLYVQPXZHRLPQ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|