C15H8ClN3S2 — CID 22693192
2-(2-chloroquinazolin-4-yl)sulfanyl-1,3-benzothiazole (PubChem CID 22693192) has the molecular formula C15H8ClN3S2 and a molecular weight of 329.84 g/mol. Its IUPAC name is 2-(2-chloroquinazolin-4-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(2-chloroquinazolin-4-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 22693192 |
| Molecular Formula | C15H8ClN3S2 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | 2-(2-chloroquinazolin-4-yl)sulfanyl-1,3-benzothiazole |
| SMILES | Clc1nc(Sc2nc3ccccc3s2)c2ccccc2n1 |
| InChI | InChI=1S/C15H8ClN3S2/c16-14-17-10-6-2-1-5-9(10)13(19-14)21-15-18-11-7-3-4-8-12(11)20-15/h1-8H |
| InChIKey | LJWKUGYXJNCRBO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |