C11H7ClN4S2 — CID 114049977
6-(1,3-benzothiazol-2-ylsulfanyl)-5-chloropyrimidin-4-amine (PubChem CID 114049977) has the molecular formula C11H7ClN4S2 and a molecular weight of 294.79 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylsulfanyl)-5-chloropyrimidin-4-amine.
| Compound Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-5-chloropyrimidin-4-amine |
|---|---|
| PubChem CID | 114049977 |
| Molecular Formula | C11H7ClN4S2 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 293.98 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-5-chloropyrimidin-4-amine |
| SMILES | Nc1ncnc(Sc2nc3ccccc3s2)c1Cl |
| InChI | InChI=1S/C11H7ClN4S2/c12-8-9(13)14-5-15-10(8)18-11-16-6-3-1-2-4-7(6)17-11/h1-5H,(H2,13,14,15) |
| InChIKey | WTPMADPCWJWKJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |