C12H8N6S2 — CID 114788221
6-(1,3-benzothiazol-2-ylsulfanyl)-7H-purin-2-amine (PubChem CID 114788221) has the molecular formula C12H8N6S2 and a molecular weight of 300.37 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylsulfanyl)-7H-purin-2-amine.
| Compound Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-7H-purin-2-amine |
|---|---|
| PubChem CID | 114788221 |
| Molecular Formula | C12H8N6S2 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.03 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-7H-purin-2-amine |
| SMILES | Nc1nc(Sc2nc3ccccc3s2)c2[nH]cnc2n1 |
| InChI | InChI=1S/C12H8N6S2/c13-11-17-9-8(14-5-15-9)10(18-11)20-12-16-6-3-1-2-4-7(6)19-12/h1-5H,(H3,13,14,15,17,18) |
| InChIKey | XISDRTHFAKCDBA-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |