C12H5F3N2S2 — CID 114072770
2-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-1,3-benzothiazole (PubChem CID 114072770) has the molecular formula C12H5F3N2S2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 2-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 114072770 |
| Molecular Formula | C12H5F3N2S2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-[(3,5,6-trifluoro-2-pyridinyl)sulfanyl]-1,3-benzothiazole |
| SMILES | Fc1cc(F)c(Sc2nc3ccccc3s2)nc1F |
| InChI | InChI=1S/C12H5F3N2S2/c13-6-5-7(14)11(17-10(6)15)19-12-16-8-3-1-2-4-9(8)18-12/h1-5H |
| InChIKey | LIFJFHOHAAKDHN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|