C12H19NS2 — CID 143023766
ethane;2-methylsulfanyl-1,3-benzothiazole (PubChem CID 143023766) has the molecular formula C12H19NS2 and a molecular weight of 241.42 g/mol. Its IUPAC name is ethane;2-methylsulfanyl-1,3-benzothiazole.
| Compound Name | ethane;2-methylsulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 143023766 |
| Molecular Formula | C12H19NS2 |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | ethane;2-methylsulfanyl-1,3-benzothiazole |
| SMILES | CC.CC.CSc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS2.2C2H6/c1-10-8-9-6-4-2-3-5-7(6)11-8;2*1-2/h2-5H,1H3;2*1-2H3 |
| InChIKey | MCRKWJJGQGKZAD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |