C15H25N3S2 — CID 88838043
N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine;2-methylpropan-2-amine (PubChem CID 88838043) has the molecular formula C15H25N3S2 and a molecular weight of 311.52 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine;2-methylpropan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine;2-methylpropan-2-amine |
|---|---|
| PubChem CID | 88838043 |
| Molecular Formula | C15H25N3S2 |
| Molecular Weight | 311.52 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylpropan-2-amine;2-methylpropan-2-amine |
| SMILES | CC(C)(C)N.CC(C)(C)NSc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H14N2S2.C4H11N/c1-11(2,3)13-15-10-12-8-6-4-5-7-9(8)14-10;1-4(2,3)5/h4-7,13H,1-3H3;5H2,1-3H3 |
| InChIKey | WQHSKHYLEBAVHH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|