C11H8N2OS2 — CID 5026590
N-(1,3-benzothiazol-2-ylsulfanyl)furan-2-amine (PubChem CID 5026590) has the molecular formula C11H8N2OS2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)furan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)furan-2-amine |
|---|---|
| PubChem CID | 5026590 |
| Molecular Formula | C11H8N2OS2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)furan-2-amine |
| SMILES | c1coc(NSc2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C11H8N2OS2/c1-2-5-9-8(4-1)12-11(15-9)16-13-10-6-3-7-14-10/h1-7,13H |
| InChIKey | QPQDHXDWZIUPRK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|