C12H16N2S2 — CID 64613650
3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylbutan-2-amine (PubChem CID 64613650) has the molecular formula C12H16N2S2 and a molecular weight of 252.41 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylbutan-2-amine.
| Compound Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylbutan-2-amine |
|---|---|
| PubChem CID | 64613650 |
| Molecular Formula | C12H16N2S2 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-(1,3-benzothiazol-2-ylsulfanyl)-N-methylbutan-2-amine |
| SMILES | CNC(C)C(C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C12H16N2S2/c1-8(13-3)9(2)15-12-14-10-6-4-5-7-11(10)16-12/h4-9,13H,1-3H3 |
| InChIKey | VSBYYIIBMJNDTH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |