C15H22N2S2 — CID 62578544
N-[2-(1,3-benzothiazol-2-ylsulfanyl)propyl]pentan-1-amine (PubChem CID 62578544) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylsulfanyl)propyl]pentan-1-amine.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)propyl]pentan-1-amine |
|---|---|
| PubChem CID | 62578544 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylsulfanyl)propyl]pentan-1-amine |
| SMILES | CCCCCNCC(C)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H22N2S2/c1-3-4-7-10-16-11-12(2)18-15-17-13-8-5-6-9-14(13)19-15/h5-6,8-9,12,16H,3-4,7,10-11H2,1-2H3 |
| InChIKey | RXVHUVMRVHCQBJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|