C15H22N2S2 — CID 21196957
N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylheptan-2-amine (PubChem CID 21196957) has the molecular formula C15H22N2S2 and a molecular weight of 294.49 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylheptan-2-amine.
| Compound Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylheptan-2-amine |
|---|---|
| PubChem CID | 21196957 |
| Molecular Formula | C15H22N2S2 |
| Molecular Weight | 294.49 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylsulfanyl)-2-methylheptan-2-amine |
| SMILES | CCCCCC(C)(C)NSc1nc2ccccc2s1 |
| InChI | InChI=1S/C15H22N2S2/c1-4-5-8-11-15(2,3)17-19-14-16-12-9-6-7-10-13(12)18-14/h6-7,9-10,17H,4-5,8,11H2,1-3H3 |
| InChIKey | HYTVXGJWOSUMEI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|