C18H16N2S6 — CID 18349410
2-[4-(1,3-benzothiazol-2-yldisulfanyl)butyldisulfanyl]-1,3-benzothiazole (PubChem CID 18349410) has the molecular formula C18H16N2S6 and a molecular weight of 452.74 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-yldisulfanyl)butyldisulfanyl]-1,3-benzothiazole.
| Compound Name | 2-[4-(1,3-benzothiazol-2-yldisulfanyl)butyldisulfanyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 18349410 |
| Molecular Formula | C18H16N2S6 |
| Molecular Weight | 452.74 g/mol |
| Exact Mass | 451.96 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-yldisulfanyl)butyldisulfanyl]-1,3-benzothiazole |
| SMILES | c1ccc2sc(SSCCCCSSc3nc4ccccc4s3)nc2c1 |
| InChI | InChI=1S/C18H16N2S6/c1-3-9-15-13(7-1)19-17(23-15)25-21-11-5-6-12-22-26-18-20-14-8-2-4-10-16(14)24-18/h1-4,7-10H,5-6,11-12H2 |
| InChIKey | BTPMVCNRPLMXEM-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.74 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|